C46H47BN2 — CID 163415726
4,18-ditert-butyl-8-(4-tert-butylphenyl)-14-naphthalen-2-yl-8,14-diaza-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9(21),10,12,15(20),16,18-nonaene (PubChem CID 163415726) has the molecular formula C46H47BN2 and a molecular weight of 638.71 g/mol. Its IUPAC name is 4,18-ditert-butyl-8-(4-tert-butylphenyl)-14-naphthalen-2-yl-8,14-diaza-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9(21),10,12,15(20),16,18-nonaene.
| Compound Name | 4,18-ditert-butyl-8-(4-tert-butylphenyl)-14-naphthalen-2-yl-8,14-diaza-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9(21),10,12,15(20),16,18-nonaene |
|---|---|
| PubChem CID | 163415726 |
| Molecular Formula | C46H47BN2 |
| Molecular Weight | 638.71 g/mol |
| Exact Mass | 638.38 |
| IUPAC Name | 4,18-ditert-butyl-8-(4-tert-butylphenyl)-14-naphthalen-2-yl-8,14-diaza-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9(21),10,12,15(20),16,18-nonaene |
| SMILES | CC(C)(C)c1ccc(N2c3ccc(C(C)(C)C)cc3B3c4cc(C(C)(C)C)ccc4N(c4ccc5ccccc5c4)c4cccc2c43)cc1 |
| InChI | InChI=1S/C46H47BN2/c1-44(2,3)32-18-23-35(24-19-32)48-39-25-20-33(45(4,5)6)28-37(39)47-38-29-34(46(7,8)9)21-26-40(38)49(42-16-12-15-41(48)43(42)47)36-22-17-30-13-10-11-14-31(30)27-36/h10-29H,1-9H3 |
| InChIKey | AEFOXYVDLQONBR-UHFFFAOYSA-N |
| XLogP | 10.81 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.71 |
| LogP ≤ 5 | 10.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|