C50H55BN2 — CID 161111801
4,22-ditert-butyl-8,18-bis(4-tert-butylphenyl)-8,18-diaza-1-borahexacyclo[15.7.1.02,7.09,25.010,15.019,24]pentacosa-2(7),3,5,9(25),10,12,14,16,19(24),20,22-undecaene (PubChem CID 161111801) has the molecular formula C50H55BN2 and a molecular weight of 694.82 g/mol. Its IUPAC name is 4,22-ditert-butyl-8,18-bis(4-tert-butylphenyl)-8,18-diaza-1-borahexacyclo[15.7.1.02,7.09,25.010,15.019,24]pentacosa-2(7),3,5,9(25),10,12,14,16,19(24),20,22-undecaene.
| Compound Name | 4,22-ditert-butyl-8,18-bis(4-tert-butylphenyl)-8,18-diaza-1-borahexacyclo[15.7.1.02,7.09,25.010,15.019,24]pentacosa-2(7),3,5,9(25),10,12,14,16,19(24),20,22-undecaene |
|---|---|
| PubChem CID | 161111801 |
| Molecular Formula | C50H55BN2 |
| Molecular Weight | 694.82 g/mol |
| Exact Mass | 694.45 |
| IUPAC Name | 4,22-ditert-butyl-8,18-bis(4-tert-butylphenyl)-8,18-diaza-1-borahexacyclo[15.7.1.02,7.09,25.010,15.019,24]pentacosa-2(7),3,5,9(25),10,12,14,16,19(24),20,22-undecaene |
| SMILES | CC(C)(C)c1ccc(N2c3ccc(C(C)(C)C)cc3B3c4cc(C(C)(C)C)ccc4N(c4ccc(C(C)(C)C)cc4)c4c3c2cc2ccccc42)cc1 |
| InChI | InChI=1S/C50H55BN2/c1-47(2,3)33-17-23-37(24-18-33)52-42-27-21-35(49(7,8)9)30-40(42)51-41-31-36(50(10,11)12)22-28-43(41)53(38-25-19-34(20-26-38)48(4,5)6)46-39-16-14-13-15-32(39)29-44(52)45(46)51/h13-31H,1-12H3 |
| InChIKey | IMUUEJGYAVYLNS-UHFFFAOYSA-N |
| XLogP | 12.11 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.82 |
| LogP ≤ 5 | 12.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|