C43H45BN2O2 — CID 171422654
14-(1,3-benzodioxol-5-yl)-4,11-ditert-butyl-8-(4-tert-butylphenyl)-8,14-diaza-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9(21),10,12,15,17,19-nonaene (PubChem CID 171422654) has the molecular formula C43H45BN2O2 and a molecular weight of 632.66 g/mol. Its IUPAC name is 14-(1,3-benzodioxol-5-yl)-4,11-ditert-butyl-8-(4-tert-butylphenyl)-8,14-diaza-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9(21),10,12,15,17,19-nonaene.
| Compound Name | 14-(1,3-benzodioxol-5-yl)-4,11-ditert-butyl-8-(4-tert-butylphenyl)-8,14-diaza-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9(21),10,12,15,17,19-nonaene |
|---|---|
| PubChem CID | 171422654 |
| Molecular Formula | C43H45BN2O2 |
| Molecular Weight | 632.66 g/mol |
| Exact Mass | 632.36 |
| IUPAC Name | 14-(1,3-benzodioxol-5-yl)-4,11-ditert-butyl-8-(4-tert-butylphenyl)-8,14-diaza-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9(21),10,12,15,17,19-nonaene |
| SMILES | CC(C)(C)c1ccc(N2c3ccc(C(C)(C)C)cc3B3c4ccccc4N(c4ccc5c(c4)OCO5)c4cc(C(C)(C)C)cc2c43)cc1 |
| InChI | InChI=1S/C43H45BN2O2/c1-41(2,3)27-14-17-30(18-15-27)45-35-20-16-28(42(4,5)6)22-33(35)44-32-12-10-11-13-34(32)46(31-19-21-38-39(25-31)48-26-47-38)37-24-29(43(7,8)9)23-36(45)40(37)44/h10-25H,26H2,1-9H3 |
| InChIKey | NOINHUGKIULEPO-UHFFFAOYSA-N |
| XLogP | 9.39 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.66 |
| LogP ≤ 5 | 9.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|