C40H39BN2O2 — CID 171049562
4-tert-butyl-8-(4-tert-butylphenyl)-11-methyl-14-phenyl-18,20-dioxa-8,14-diaza-1-borahexacyclo[11.10.1.02,7.09,24.015,23.017,21]tetracosa-2(7),3,5,9(24),10,12,15,17(21),22-nonaene (PubChem CID 171049562) has the molecular formula C40H39BN2O2 and a molecular weight of 590.58 g/mol. Its IUPAC name is 4-tert-butyl-8-(4-tert-butylphenyl)-11-methyl-14-phenyl-18,20-dioxa-8,14-diaza-1-borahexacyclo[11.10.1.02,7.09,24.015,23.017,21]tetracosa-2(7),3,5,9(24),10,12,15,17(21),22-nonaene.
| Compound Name | 4-tert-butyl-8-(4-tert-butylphenyl)-11-methyl-14-phenyl-18,20-dioxa-8,14-diaza-1-borahexacyclo[11.10.1.02,7.09,24.015,23.017,21]tetracosa-2(7),3,5,9(24),10,12,15,17(21),22-nonaene |
|---|---|
| PubChem CID | 171049562 |
| Molecular Formula | C40H39BN2O2 |
| Molecular Weight | 590.58 g/mol |
| Exact Mass | 590.31 |
| IUPAC Name | 4-tert-butyl-8-(4-tert-butylphenyl)-11-methyl-14-phenyl-18,20-dioxa-8,14-diaza-1-borahexacyclo[11.10.1.02,7.09,24.015,23.017,21]tetracosa-2(7),3,5,9(24),10,12,15,17(21),22-nonaene |
| SMILES | Cc1cc2c3c(c1)N(c1ccccc1)c1cc4c(cc1B3c1cc(C(C)(C)C)ccc1N2c1ccc(C(C)(C)C)cc1)OCO4 |
| InChI | InChI=1S/C40H39BN2O2/c1-25-19-34-38-35(20-25)43(28-11-9-8-10-12-28)33-23-37-36(44-24-45-37)22-31(33)41(38)30-21-27(40(5,6)7)15-18-32(30)42(34)29-16-13-26(14-17-29)39(2,3)4/h8-23H,24H2,1-7H3 |
| InChIKey | UJDSHFVVHXHWMO-UHFFFAOYSA-N |
| XLogP | 8.40 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.58 |
| LogP ≤ 5 | 8.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|