C41H41BN2O2 — CID 171049834
22-tert-butyl-18-(4-tert-butylphenyl)-15-methyl-12-phenyl-6,9-dioxa-12,18-diaza-1-borahexacyclo[11.11.1.02,11.05,10.017,25.019,24]pentacosa-2(11),3,5(10),13,15,17(25),19(24),20,22-nonaene (PubChem CID 171049834) has the molecular formula C41H41BN2O2 and a molecular weight of 604.60 g/mol. Its IUPAC name is 22-tert-butyl-18-(4-tert-butylphenyl)-15-methyl-12-phenyl-6,9-dioxa-12,18-diaza-1-borahexacyclo[11.11.1.02,11.05,10.017,25.019,24]pentacosa-2(11),3,5(10),13,15,17(25),19(24),20,22-nonaene.
| Compound Name | 22-tert-butyl-18-(4-tert-butylphenyl)-15-methyl-12-phenyl-6,9-dioxa-12,18-diaza-1-borahexacyclo[11.11.1.02,11.05,10.017,25.019,24]pentacosa-2(11),3,5(10),13,15,17(25),19(24),20,22-nonaene |
|---|---|
| PubChem CID | 171049834 |
| Molecular Formula | C41H41BN2O2 |
| Molecular Weight | 604.60 g/mol |
| Exact Mass | 604.33 |
| IUPAC Name | 22-tert-butyl-18-(4-tert-butylphenyl)-15-methyl-12-phenyl-6,9-dioxa-12,18-diaza-1-borahexacyclo[11.11.1.02,11.05,10.017,25.019,24]pentacosa-2(11),3,5(10),13,15,17(25),19(24),20,22-nonaene |
| SMILES | Cc1cc2c3c(c1)N(c1ccccc1)c1c(ccc4c1OCCO4)B3c1cc(C(C)(C)C)ccc1N2c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C41H41BN2O2/c1-26-23-34-37-35(24-26)44(29-11-9-8-10-12-29)38-31(18-20-36-39(38)46-22-21-45-36)42(37)32-25-28(41(5,6)7)15-19-33(32)43(34)30-16-13-27(14-17-30)40(2,3)4/h8-20,23-25H,21-22H2,1-7H3 |
| InChIKey | IUCQWHQIPOFXDC-UHFFFAOYSA-N |
| XLogP | 8.44 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.60 |
| LogP ≤ 5 | 8.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|