C41H39BN2O — CID 164708855
4-tert-butyl-8-(4-tert-butylphenyl)-11-methyl-14-phenyl-22-oxa-8,14-diaza-1-borahexacyclo[11.10.1.02,7.09,24.015,23.016,21]tetracosa-2(7),3,5,9(24),10,12,15(23),16,18,20-decaene (PubChem CID 164708855) has the molecular formula C41H39BN2O and a molecular weight of 586.59 g/mol. Its IUPAC name is 4-tert-butyl-8-(4-tert-butylphenyl)-11-methyl-14-phenyl-22-oxa-8,14-diaza-1-borahexacyclo[11.10.1.02,7.09,24.015,23.016,21]tetracosa-2(7),3,5,9(24),10,12,15(23),16,18,20-decaene.
| Compound Name | 4-tert-butyl-8-(4-tert-butylphenyl)-11-methyl-14-phenyl-22-oxa-8,14-diaza-1-borahexacyclo[11.10.1.02,7.09,24.015,23.016,21]tetracosa-2(7),3,5,9(24),10,12,15(23),16,18,20-decaene |
|---|---|
| PubChem CID | 164708855 |
| Molecular Formula | C41H39BN2O |
| Molecular Weight | 586.59 g/mol |
| Exact Mass | 586.32 |
| IUPAC Name | 4-tert-butyl-8-(4-tert-butylphenyl)-11-methyl-14-phenyl-22-oxa-8,14-diaza-1-borahexacyclo[11.10.1.02,7.09,24.015,23.016,21]tetracosa-2(7),3,5,9(24),10,12,15(23),16,18,20-decaene |
| SMILES | Cc1cc2c3c(c1)N(c1ccccc1)c1c(oc4ccccc14)B3c1cc(C(C)(C)C)ccc1N2c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C41H39BN2O/c1-26-23-34-37-35(24-26)44(29-13-9-8-10-14-29)38-31-15-11-12-16-36(31)45-39(38)42(37)32-25-28(41(5,6)7)19-22-33(32)43(34)30-20-17-27(18-21-30)40(2,3)4/h8-25H,1-7H3 |
| InChIKey | QWHFNFLSJKQPEC-UHFFFAOYSA-N |
| XLogP | 9.42 |
| TPSA | 19.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.59 |
| LogP ≤ 5 | 9.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|