C43H47BN2O — CID 164842102
26-tert-butyl-11-(4-tert-butylphenyl)-14,18,23-trimethyl-3-oxa-11,17-diaza-1-boraoctacyclo[14.12.1.117,24.02,10.04,9.012,29.018,23.028,30]triaconta-2(10),4,6,8,12(29),13,15,24(30),25,27-decaene (PubChem CID 164842102) has the molecular formula C43H47BN2O and a molecular weight of 618.67 g/mol. Its IUPAC name is 26-tert-butyl-11-(4-tert-butylphenyl)-14,18,23-trimethyl-3-oxa-11,17-diaza-1-boraoctacyclo[14.12.1.117,24.02,10.04,9.012,29.018,23.028,30]triaconta-2(10),4,6,8,12(29),13,15,24(30),25,27-decaene.
| Compound Name | 26-tert-butyl-11-(4-tert-butylphenyl)-14,18,23-trimethyl-3-oxa-11,17-diaza-1-boraoctacyclo[14.12.1.117,24.02,10.04,9.012,29.018,23.028,30]triaconta-2(10),4,6,8,12(29),13,15,24(30),25,27-decaene |
|---|---|
| PubChem CID | 164842102 |
| Molecular Formula | C43H47BN2O |
| Molecular Weight | 618.67 g/mol |
| Exact Mass | 618.38 |
| IUPAC Name | 26-tert-butyl-11-(4-tert-butylphenyl)-14,18,23-trimethyl-3-oxa-11,17-diaza-1-boraoctacyclo[14.12.1.117,24.02,10.04,9.012,29.018,23.028,30]triaconta-2(10),4,6,8,12(29),13,15,24(30),25,27-decaene |
| SMILES | Cc1cc2c3c(c1)N1c4c(cc(C(C)(C)C)cc4C4(C)CCCCC14C)B3c1oc3ccccc3c1N2c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C43H47BN2O/c1-26-22-33-36-34(23-26)46-38-31(42(8)20-12-13-21-43(42,46)9)24-28(41(5,6)7)25-32(38)44(36)39-37(30-14-10-11-15-35(30)47-39)45(33)29-18-16-27(17-19-29)40(2,3)4/h10-11,14-19,22-25H,12-13,20-21H2,1-9H3 |
| InChIKey | QHTRALQIVSVNKT-UHFFFAOYSA-N |
| XLogP | 9.69 |
| TPSA | 19.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.67 |
| LogP ≤ 5 | 9.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|