C44H53BN2 — CID 166014305
11,17-ditert-butyl-21-(4-tert-butylphenyl)-3,8-dimethyl-2,21-diaza-14-boraheptacyclo[12.11.1.12,9.03,8.015,20.022,26.013,27]heptacosa-1(25),9(27),10,12,15(20),16,18,22(26),23-nonaene (PubChem CID 166014305) has the molecular formula C44H53BN2 and a molecular weight of 620.73 g/mol. Its IUPAC name is 11,17-ditert-butyl-21-(4-tert-butylphenyl)-3,8-dimethyl-2,21-diaza-14-boraheptacyclo[12.11.1.12,9.03,8.015,20.022,26.013,27]heptacosa-1(25),9(27),10,12,15(20),16,18,22(26),23-nonaene.
| Compound Name | 11,17-ditert-butyl-21-(4-tert-butylphenyl)-3,8-dimethyl-2,21-diaza-14-boraheptacyclo[12.11.1.12,9.03,8.015,20.022,26.013,27]heptacosa-1(25),9(27),10,12,15(20),16,18,22(26),23-nonaene |
|---|---|
| PubChem CID | 166014305 |
| Molecular Formula | C44H53BN2 |
| Molecular Weight | 620.73 g/mol |
| Exact Mass | 620.43 |
| IUPAC Name | 11,17-ditert-butyl-21-(4-tert-butylphenyl)-3,8-dimethyl-2,21-diaza-14-boraheptacyclo[12.11.1.12,9.03,8.015,20.022,26.013,27]heptacosa-1(25),9(27),10,12,15(20),16,18,22(26),23-nonaene |
| SMILES | CC(C)(C)c1ccc(N2c3ccc(C(C)(C)C)cc3B3c4cc(C(C)(C)C)cc5c4N(c4cccc2c43)C2(C)CCCCC52C)cc1 |
| InChI | InChI=1S/C44H53BN2/c1-40(2,3)28-17-20-31(21-18-28)46-35-22-19-29(41(4,5)6)26-33(35)45-34-27-30(42(7,8)9)25-32-39(34)47(37-16-14-15-36(46)38(37)45)44(11)24-13-12-23-43(32,44)10/h14-22,25-27H,12-13,23-24H2,1-11H3 |
| InChIKey | KHBVXICUWBNGNU-UHFFFAOYSA-N |
| XLogP | 9.93 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.73 |
| LogP ≤ 5 | 9.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|