C41H47BN2 — CID 166014909
17-tert-butyl-21-(4-tert-butylphenyl)-3,8,11-trimethyl-2,21-diaza-14-boraheptacyclo[12.11.1.12,9.03,8.015,20.022,26.013,27]heptacosa-1(25),9(27),10,12,15(20),16,18,22(26),23-nonaene (PubChem CID 166014909) has the molecular formula C41H47BN2 and a molecular weight of 578.65 g/mol. Its IUPAC name is 17-tert-butyl-21-(4-tert-butylphenyl)-3,8,11-trimethyl-2,21-diaza-14-boraheptacyclo[12.11.1.12,9.03,8.015,20.022,26.013,27]heptacosa-1(25),9(27),10,12,15(20),16,18,22(26),23-nonaene.
| Compound Name | 17-tert-butyl-21-(4-tert-butylphenyl)-3,8,11-trimethyl-2,21-diaza-14-boraheptacyclo[12.11.1.12,9.03,8.015,20.022,26.013,27]heptacosa-1(25),9(27),10,12,15(20),16,18,22(26),23-nonaene |
|---|---|
| PubChem CID | 166014909 |
| Molecular Formula | C41H47BN2 |
| Molecular Weight | 578.65 g/mol |
| Exact Mass | 578.38 |
| IUPAC Name | 17-tert-butyl-21-(4-tert-butylphenyl)-3,8,11-trimethyl-2,21-diaza-14-boraheptacyclo[12.11.1.12,9.03,8.015,20.022,26.013,27]heptacosa-1(25),9(27),10,12,15(20),16,18,22(26),23-nonaene |
| SMILES | Cc1cc2c3c(c1)C1(C)CCCCC1(C)N3c1cccc3c1B2c1cc(C(C)(C)C)ccc1N3c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C41H47BN2/c1-26-23-30-37-32(24-26)42-31-25-28(39(5,6)7)17-20-33(31)43(29-18-15-27(16-19-29)38(2,3)4)34-13-12-14-35(36(34)42)44(37)41(9)22-11-10-21-40(30,41)8/h12-20,23-25H,10-11,21-22H2,1-9H3 |
| InChIKey | BZOOSQZIFAELGT-UHFFFAOYSA-N |
| XLogP | 8.94 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.65 |
| LogP ≤ 5 | 8.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|