C17H17N — CID 90908719
4-(3,5-dimethylphenyl)-3,5-dimethylbenzonitrile (PubChem CID 90908719) has the molecular formula C17H17N and a molecular weight of 235.33 g/mol. Its IUPAC name is 4-(3,5-dimethylphenyl)-3,5-dimethylbenzonitrile.
| Compound Name | 4-(3,5-dimethylphenyl)-3,5-dimethylbenzonitrile |
|---|---|
| PubChem CID | 90908719 |
| Molecular Formula | C17H17N |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.14 |
| IUPAC Name | 4-(3,5-dimethylphenyl)-3,5-dimethylbenzonitrile |
| SMILES | Cc1cc(C)cc(-c2c(C)cc(C#N)cc2C)c1 |
| InChI | InChI=1S/C17H17N/c1-11-5-12(2)7-16(6-11)17-13(3)8-15(10-18)9-14(17)4/h5-9H,1-4H3 |
| InChIKey | JONOWHUTOAEYFW-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |