C70H54N4 — CID 146237910
3,5-bis[3,6-bis(3,5-dimethylphenyl)carbazol-9-yl]-4-(3-cyanophenyl)benzonitrile (PubChem CID 146237910) has the molecular formula C70H54N4 and a molecular weight of 951.23 g/mol. Its IUPAC name is 3,5-bis[3,6-bis(3,5-dimethylphenyl)carbazol-9-yl]-4-(3-cyanophenyl)benzonitrile.
| Compound Name | 3,5-bis[3,6-bis(3,5-dimethylphenyl)carbazol-9-yl]-4-(3-cyanophenyl)benzonitrile |
|---|---|
| PubChem CID | 146237910 |
| Molecular Formula | C70H54N4 |
| Molecular Weight | 951.23 g/mol |
| Exact Mass | 950.43 |
| IUPAC Name | 3,5-bis[3,6-bis(3,5-dimethylphenyl)carbazol-9-yl]-4-(3-cyanophenyl)benzonitrile |
| SMILES | Cc1cc(C)cc(-c2ccc3c(c2)c2cc(-c4cc(C)cc(C)c4)ccc2n3-c2cc(C#N)cc(-n3c4ccc(-c5cc(C)cc(C)c5)cc4c4cc(-c5cc(C)cc(C)c5)ccc43)c2-c2cccc(C#N)c2)c1 |
| InChI | InChI=1S/C70H54N4/c1-41-20-42(2)25-56(24-41)51-12-16-64-60(35-51)61-36-52(57-26-43(3)21-44(4)27-57)13-17-65(61)73(64)68-33-50(40-72)34-69(70(68)55-11-9-10-49(32-55)39-71)74-66-18-14-53(58-28-45(5)22-46(6)29-58)37-62(66)63-38-54(15-19-67(63)74)59-30-47(7)23-48(8)31-59/h9-38H,1-8H3 |
| InChIKey | ABBWEHQKTWBPJL-UHFFFAOYSA-N |
| XLogP | 18.43 |
| TPSA | 57.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 74 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 951.23 |
| LogP ≤ 5 | 18.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |