C69H56N4 — CID 155216625
3,5-bis[3,6-bis(3,5-dimethylphenyl)carbazol-9-yl]-4-(6-methyl-2-pyridinyl)benzonitrile (PubChem CID 155216625) has the molecular formula C69H56N4 and a molecular weight of 941.23 g/mol. Its IUPAC name is 3,5-bis[3,6-bis(3,5-dimethylphenyl)carbazol-9-yl]-4-(6-methyl-2-pyridinyl)benzonitrile.
| Compound Name | 3,5-bis[3,6-bis(3,5-dimethylphenyl)carbazol-9-yl]-4-(6-methyl-2-pyridinyl)benzonitrile |
|---|---|
| PubChem CID | 155216625 |
| Molecular Formula | C69H56N4 |
| Molecular Weight | 941.23 g/mol |
| Exact Mass | 940.45 |
| IUPAC Name | 3,5-bis[3,6-bis(3,5-dimethylphenyl)carbazol-9-yl]-4-(6-methyl-2-pyridinyl)benzonitrile |
| SMILES | Cc1cc(C)cc(-c2ccc3c(c2)c2cc(-c4cc(C)cc(C)c4)ccc2n3-c2cc(C#N)cc(-n3c4ccc(-c5cc(C)cc(C)c5)cc4c4cc(-c5cc(C)cc(C)c5)ccc43)c2-c2cccc(C)n2)c1 |
| InChI | InChI=1S/C69H56N4/c1-40-21-41(2)26-54(25-40)50-13-17-63-58(35-50)59-36-51(55-27-42(3)22-43(4)28-55)14-18-64(59)72(63)67-33-49(39-70)34-68(69(67)62-12-10-11-48(9)71-62)73-65-19-15-52(56-29-44(5)23-45(6)30-56)37-60(65)61-38-53(16-20-66(61)73)57-31-46(7)24-47(8)32-57/h10-38H,1-9H3 |
| InChIKey | RZDMOGIBLHHBMG-UHFFFAOYSA-N |
| XLogP | 18.26 |
| TPSA | 46.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 73 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 941.23 |
| LogP ≤ 5 | 18.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |