C15H12FN — CID 82115047
3-(3,5-dimethylphenyl)-4-fluorobenzonitrile (PubChem CID 82115047) has the molecular formula C15H12FN and a molecular weight of 225.27 g/mol. Its IUPAC name is 3-(3,5-dimethylphenyl)-4-fluorobenzonitrile.
| Compound Name | 3-(3,5-dimethylphenyl)-4-fluorobenzonitrile |
|---|---|
| PubChem CID | 82115047 |
| Molecular Formula | C15H12FN |
| Molecular Weight | 225.27 g/mol |
| Exact Mass | 225.10 |
| IUPAC Name | 3-(3,5-dimethylphenyl)-4-fluorobenzonitrile |
| SMILES | Cc1cc(C)cc(-c2cc(C#N)ccc2F)c1 |
| InChI | InChI=1S/C15H12FN/c1-10-5-11(2)7-13(6-10)14-8-12(9-17)3-4-15(14)16/h3-8H,1-2H3 |
| InChIKey | CEBRPECHLIYYML-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.27 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |