C28H20N4 — CID 146653910
2-[4-(9,9-dimethylacridin-10-yl)phenyl]pyridine-3,5-dicarbonitrile (PubChem CID 146653910) has the molecular formula C28H20N4 and a molecular weight of 412.50 g/mol. Its IUPAC name is 2-[4-(9,9-dimethylacridin-10-yl)phenyl]pyridine-3,5-dicarbonitrile.
| Compound Name | 2-[4-(9,9-dimethylacridin-10-yl)phenyl]pyridine-3,5-dicarbonitrile |
|---|---|
| PubChem CID | 146653910 |
| Molecular Formula | C28H20N4 |
| Molecular Weight | 412.50 g/mol |
| Exact Mass | 412.17 |
| IUPAC Name | 2-[4-(9,9-dimethylacridin-10-yl)phenyl]pyridine-3,5-dicarbonitrile |
| SMILES | CC1(C)c2ccccc2N(c2ccc(-c3ncc(C#N)cc3C#N)cc2)c2ccccc21 |
| InChI | InChI=1S/C28H20N4/c1-28(2)23-7-3-5-9-25(23)32(26-10-6-4-8-24(26)28)22-13-11-20(12-14-22)27-21(17-30)15-19(16-29)18-31-27/h3-15,18H,1-2H3 |
| InChIKey | DMNDWWJDWXRJTB-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 63.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.50 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |