C29H24N2 — CID 122435842
2-[4-(9,9-dimethylacridin-10-yl)phenyl]-5-methylbenzonitrile (PubChem CID 122435842) has the molecular formula C29H24N2 and a molecular weight of 400.53 g/mol. Its IUPAC name is 2-[4-(9,9-dimethylacridin-10-yl)phenyl]-5-methylbenzonitrile.
| Compound Name | 2-[4-(9,9-dimethylacridin-10-yl)phenyl]-5-methylbenzonitrile |
|---|---|
| PubChem CID | 122435842 |
| Molecular Formula | C29H24N2 |
| Molecular Weight | 400.53 g/mol |
| Exact Mass | 400.19 |
| IUPAC Name | 2-[4-(9,9-dimethylacridin-10-yl)phenyl]-5-methylbenzonitrile |
| SMILES | Cc1ccc(-c2ccc(N3c4ccccc4C(C)(C)c4ccccc43)cc2)c(C#N)c1 |
| InChI | InChI=1S/C29H24N2/c1-20-12-17-24(22(18-20)19-30)21-13-15-23(16-14-21)31-27-10-6-4-8-25(27)29(2,3)26-9-5-7-11-28(26)31/h4-18H,1-3H3 |
| InChIKey | SPODKBPUGUVFQJ-UHFFFAOYSA-N |
| XLogP | 7.64 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.53 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |