C23H17N3 — CID 145009819
2-(9,9-dimethylacridin-10-yl)benzene-1,3-dicarbonitrile (PubChem CID 145009819) has the molecular formula C23H17N3 and a molecular weight of 335.41 g/mol. Its IUPAC name is 2-(9,9-dimethylacridin-10-yl)benzene-1,3-dicarbonitrile.
| Compound Name | 2-(9,9-dimethylacridin-10-yl)benzene-1,3-dicarbonitrile |
|---|---|
| PubChem CID | 145009819 |
| Molecular Formula | C23H17N3 |
| Molecular Weight | 335.41 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | 2-(9,9-dimethylacridin-10-yl)benzene-1,3-dicarbonitrile |
| SMILES | CC1(C)c2ccccc2N(c2c(C#N)cccc2C#N)c2ccccc21 |
| InChI | InChI=1S/C23H17N3/c1-23(2)18-10-3-5-12-20(18)26(21-13-6-4-11-19(21)23)22-16(14-24)8-7-9-17(22)15-25/h3-13H,1-2H3 |
| InChIKey | WWUXQRJPCINQNU-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 50.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.41 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |