C57H48N2O — CID 145320537
[2,5-bis[4-(9,9-dimethylacridin-10-yl)phenyl]-4-methylphenyl]-(4-methylphenyl)methanone (PubChem CID 145320537) has the molecular formula C57H48N2O and a molecular weight of 777.02 g/mol. Its IUPAC name is [2,5-bis[4-(9,9-dimethylacridin-10-yl)phenyl]-4-methylphenyl]-(4-methylphenyl)methanone.
| Compound Name | [2,5-bis[4-(9,9-dimethylacridin-10-yl)phenyl]-4-methylphenyl]-(4-methylphenyl)methanone |
|---|---|
| PubChem CID | 145320537 |
| Molecular Formula | C57H48N2O |
| Molecular Weight | 777.02 g/mol |
| Exact Mass | 776.38 |
| IUPAC Name | [2,5-bis[4-(9,9-dimethylacridin-10-yl)phenyl]-4-methylphenyl]-(4-methylphenyl)methanone |
| SMILES | Cc1ccc(C(=O)c2cc(-c3ccc(N4c5ccccc5C(C)(C)c5ccccc54)cc3)c(C)cc2-c2ccc(N3c4ccccc4C(C)(C)c4ccccc43)cc2)cc1 |
| InChI | InChI=1S/C57H48N2O/c1-37-23-25-41(26-24-37)55(60)46-36-44(39-27-31-42(32-28-39)58-51-19-11-7-15-47(51)56(3,4)48-16-8-12-20-52(48)58)38(2)35-45(46)40-29-33-43(34-30-40)59-53-21-13-9-17-49(53)57(5,6)50-18-10-14-22-54(50)59/h7-36H,1-6H3 |
| InChIKey | WZEOCWAWQLUWKR-UHFFFAOYSA-N |
| XLogP | 15.09 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 777.02 |
| LogP ≤ 5 | 15.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |