C43H37N3 — CID 177422791
[2-[4-(9,9-dimethylacridin-10-yl)phenyl]-3-(4-methylbenzenecarboximidoyl)phenyl]-(4-methylphenyl)methanimine (PubChem CID 177422791) has the molecular formula C43H37N3 and a molecular weight of 595.79 g/mol. Its IUPAC name is [2-[4-(9,9-dimethylacridin-10-yl)phenyl]-3-(4-methylbenzenecarboximidoyl)phenyl]-(4-methylphenyl)methanimine.
| Compound Name | [2-[4-(9,9-dimethylacridin-10-yl)phenyl]-3-(4-methylbenzenecarboximidoyl)phenyl]-(4-methylphenyl)methanimine |
|---|---|
| PubChem CID | 177422791 |
| Molecular Formula | C43H37N3 |
| Molecular Weight | 595.79 g/mol |
| Exact Mass | 595.30 |
| IUPAC Name | [2-[4-(9,9-dimethylacridin-10-yl)phenyl]-3-(4-methylbenzenecarboximidoyl)phenyl]-(4-methylphenyl)methanimine |
| SMILES | [H]/N=C(\c1ccc(C)cc1)c1cccc(/C(=N/[H])c2ccc(C)cc2)c1-c1ccc(N2c3ccccc3C(C)(C)c3ccccc32)cc1 |
| InChI | InChI=1S/C43H37N3/c1-28-16-20-31(21-17-28)41(44)34-10-9-11-35(42(45)32-22-18-29(2)19-23-32)40(34)30-24-26-33(27-25-30)46-38-14-7-5-12-36(38)43(3,4)37-13-6-8-15-39(37)46/h5-27,44-45H,1-4H3/b44-41+,45-42+ |
| InChIKey | XYQLSAAJFAXUSZ-XGGPBGRXSA-N |
| XLogP | 10.91 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.79 |
| LogP ≤ 5 | 10.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|