About CID 166569769
CID 166569769 (PubChem CID 166569769) has the molecular formula C39H13N8O
and a molecular weight of 609.59 g/mol.
Molecular Properties
| Compound Name | CID 166569769 |
| PubChem CID | 166569769 |
| Molecular Formula | C39H13N8O |
| Molecular Weight | 609.59 g/mol |
| Exact Mass | 609.12 |
| IUPAC Name | — |
| SMILES | [C-]#[N+]c1cc(C#N)cc(C#N)c1[C](c1cc(C#N)c(-c2ccc3c(c2)oc2ccccc23)c(C#N)c1)c1c(C#N)cc(C#N)cc1[N+]#[C-] |
| InChI | InChI=1S/C39H13N8O/c1-46-32-11-22(16-40)9-26(18-42)37(32)39(38-27(19-43)10-23(17-41)12-33(38)47-2)25-13-28(20-44)36(29(14-25)21-45)24-7-8-31-30-5-3-4-6-34(30)48-35(31)15-24/h3-15H |
| InChIKey | KNKWGOYOCQHGJK-UHFFFAOYSA-N |
| XLogP | 8.60 |
| TPSA | 164.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 48 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 609.59 |
| LogP ≤ 5 | 8.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze CID 166569769 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 166569769?
The IUPAC name of CID 166569769 (CID 166569769) is not available.
What is the SMILES notation for CID 166569769?
The canonical SMILES for CID 166569769 is [C-]#[N+]c1cc(C#N)cc(C#N)c1[C](c1cc(C#N)c(-c2ccc3c(c2)oc2ccccc23)c(C#N)c1)c1c(C#N)cc(C#N)cc1[N+]#[C-].
What is the InChIKey of CID 166569769?
The InChIKey is KNKWGOYOCQHGJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C39H13N8O/c1-46-32-11-22(16-40)9-26(18-42)37(32)39(38-27(19-43)10-23(17-41)12-33(38)47-2)25-13-28(20-44)36(29(14-25)21-45)24-7-8-31-30-5-3-4-6-34(30)48-35(31)15-24/h3-15H.
What are the key properties of CID 166569769?
CID 166569769 has a molecular weight of 609.59 g/mol, XLogP of 8.60, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for CID 166569769 is sourced from PubChem (CID 166569769), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).