C40H18N4O2S — CID 167017394
2-[3,5-bis(7-cyanodibenzofuran-3-yl)phenyl]-1,3-benzothiazole-6-carbonitrile (PubChem CID 167017394) has the molecular formula C40H18N4O2S and a molecular weight of 618.68 g/mol. Its IUPAC name is 2-[3,5-bis(7-cyanodibenzofuran-3-yl)phenyl]-1,3-benzothiazole-6-carbonitrile.
| Compound Name | 2-[3,5-bis(7-cyanodibenzofuran-3-yl)phenyl]-1,3-benzothiazole-6-carbonitrile |
|---|---|
| PubChem CID | 167017394 |
| Molecular Formula | C40H18N4O2S |
| Molecular Weight | 618.68 g/mol |
| Exact Mass | 618.12 |
| IUPAC Name | 2-[3,5-bis(7-cyanodibenzofuran-3-yl)phenyl]-1,3-benzothiazole-6-carbonitrile |
| SMILES | N#Cc1ccc2c(c1)oc1cc(-c3cc(-c4ccc5c(c4)oc4cc(C#N)ccc45)cc(-c4nc5ccc(C#N)cc5s4)c3)ccc12 |
| InChI | InChI=1S/C40H18N4O2S/c41-19-22-1-6-30-32-8-4-25(17-37(32)45-35(30)11-22)27-14-28(16-29(15-27)40-44-34-10-3-24(21-43)13-39(34)47-40)26-5-9-33-31-7-2-23(20-42)12-36(31)46-38(33)18-26/h1-18H |
| InChIKey | CJWSRDGTPWLHDK-UHFFFAOYSA-N |
| XLogP | 10.71 |
| TPSA | 110.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.68 |
| LogP ≤ 5 | 10.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |