C42H27N3S3Si — CID 174001758
7-[3-(7-cyanodibenzothiophen-3-yl)-5-(6-trimethylsilyl-1,3-benzothiazol-2-yl)phenyl]dibenzothiophene-3-carbonitrile (PubChem CID 174001758) has the molecular formula C42H27N3S3Si and a molecular weight of 697.99 g/mol. Its IUPAC name is 7-[3-(7-cyanodibenzothiophen-3-yl)-5-(6-trimethylsilyl-1,3-benzothiazol-2-yl)phenyl]dibenzothiophene-3-carbonitrile.
| Compound Name | 7-[3-(7-cyanodibenzothiophen-3-yl)-5-(6-trimethylsilyl-1,3-benzothiazol-2-yl)phenyl]dibenzothiophene-3-carbonitrile |
|---|---|
| PubChem CID | 174001758 |
| Molecular Formula | C42H27N3S3Si |
| Molecular Weight | 697.99 g/mol |
| Exact Mass | 697.11 |
| IUPAC Name | 7-[3-(7-cyanodibenzothiophen-3-yl)-5-(6-trimethylsilyl-1,3-benzothiazol-2-yl)phenyl]dibenzothiophene-3-carbonitrile |
| SMILES | C[Si](C)(C)c1ccc2nc(-c3cc(-c4ccc5c(c4)sc4cc(C#N)ccc45)cc(-c4ccc5c(c4)sc4cc(C#N)ccc45)c3)sc2c1 |
| InChI | InChI=1S/C42H27N3S3Si/c1-49(2,3)31-8-13-36-41(21-31)48-42(45-36)30-17-28(26-6-11-34-32-9-4-24(22-43)14-37(32)46-39(34)19-26)16-29(18-30)27-7-12-35-33-10-5-25(23-44)15-38(33)47-40(35)20-27/h4-21H,1-3H3 |
| InChIKey | AYCMFTZAKZCBSK-UHFFFAOYSA-N |
| XLogP | 12.32 |
| TPSA | 60.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.99 |
| LogP ≤ 5 | 12.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|