C44H26N4S — CID 167017151
2-[3,5-bis(4-quinolin-8-ylphenyl)phenyl]-1,3-benzothiazole-6-carbonitrile (PubChem CID 167017151) has the molecular formula C44H26N4S and a molecular weight of 642.79 g/mol. Its IUPAC name is 2-[3,5-bis(4-quinolin-8-ylphenyl)phenyl]-1,3-benzothiazole-6-carbonitrile.
| Compound Name | 2-[3,5-bis(4-quinolin-8-ylphenyl)phenyl]-1,3-benzothiazole-6-carbonitrile |
|---|---|
| PubChem CID | 167017151 |
| Molecular Formula | C44H26N4S |
| Molecular Weight | 642.79 g/mol |
| Exact Mass | 642.19 |
| IUPAC Name | 2-[3,5-bis(4-quinolin-8-ylphenyl)phenyl]-1,3-benzothiazole-6-carbonitrile |
| SMILES | N#Cc1ccc2nc(-c3cc(-c4ccc(-c5cccc6cccnc56)cc4)cc(-c4ccc(-c5cccc6cccnc56)cc4)c3)sc2c1 |
| InChI | InChI=1S/C44H26N4S/c45-27-28-11-20-40-41(23-28)49-44(48-40)37-25-35(29-12-16-31(17-13-29)38-9-1-5-33-7-3-21-46-42(33)38)24-36(26-37)30-14-18-32(19-15-30)39-10-2-6-34-8-4-22-47-43(34)39/h1-26H |
| InChIKey | BVSKIORZPGMOKJ-UHFFFAOYSA-N |
| XLogP | 11.60 |
| TPSA | 62.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.79 |
| LogP ≤ 5 | 11.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |