C51H31N5S — CID 171421367
7-[3,5-bis(2,6-diphenylpyrimidin-4-yl)phenyl]dibenzothiophene-3-carbonitrile (PubChem CID 171421367) has the molecular formula C51H31N5S and a molecular weight of 745.91 g/mol. Its IUPAC name is 7-[3,5-bis(2,6-diphenylpyrimidin-4-yl)phenyl]dibenzothiophene-3-carbonitrile.
| Compound Name | 7-[3,5-bis(2,6-diphenylpyrimidin-4-yl)phenyl]dibenzothiophene-3-carbonitrile |
|---|---|
| PubChem CID | 171421367 |
| Molecular Formula | C51H31N5S |
| Molecular Weight | 745.91 g/mol |
| Exact Mass | 745.23 |
| IUPAC Name | 7-[3,5-bis(2,6-diphenylpyrimidin-4-yl)phenyl]dibenzothiophene-3-carbonitrile |
| SMILES | N#Cc1ccc2c(c1)sc1cc(-c3cc(-c4cc(-c5ccccc5)nc(-c5ccccc5)n4)cc(-c4cc(-c5ccccc5)nc(-c5ccccc5)n4)c3)ccc12 |
| InChI | InChI=1S/C51H31N5S/c52-32-33-21-23-42-43-24-22-38(29-49(43)57-48(42)25-33)39-26-40(46-30-44(34-13-5-1-6-14-34)53-50(55-46)36-17-9-3-10-18-36)28-41(27-39)47-31-45(35-15-7-2-8-16-35)54-51(56-47)37-19-11-4-12-20-37/h1-31H |
| InChIKey | KRHLOMFZGPUICU-UHFFFAOYSA-N |
| XLogP | 13.18 |
| TPSA | 75.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 745.91 |
| LogP ≤ 5 | 13.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |