C38H14N8 — CID 176589195
5-[3,4-bis(3-cyano-5-isocyanophenyl)-2,5-dideuterio-6-(3,5-dicyanophenyl)phenyl]benzene-1,3-dicarbonitrile (PubChem CID 176589195) has the molecular formula C38H14N8 and a molecular weight of 584.60 g/mol. Its IUPAC name is 5-[3,4-bis(3-cyano-5-isocyanophenyl)-2,5-dideuterio-6-(3,5-dicyanophenyl)phenyl]benzene-1,3-dicarbonitrile.
| Compound Name | 5-[3,4-bis(3-cyano-5-isocyanophenyl)-2,5-dideuterio-6-(3,5-dicyanophenyl)phenyl]benzene-1,3-dicarbonitrile |
|---|---|
| PubChem CID | 176589195 |
| Molecular Formula | C38H14N8 |
| Molecular Weight | 584.60 g/mol |
| Exact Mass | 584.15 |
| IUPAC Name | 5-[3,4-bis(3-cyano-5-isocyanophenyl)-2,5-dideuterio-6-(3,5-dicyanophenyl)phenyl]benzene-1,3-dicarbonitrile |
| SMILES | [2H]c1c(-c2cc(C#N)cc(C#N)c2)c(-c2cc(C#N)cc(C#N)c2)c([2H])c(-c2cc(C#N)cc([N+]#[C-])c2)c1-c1cc(C#N)cc([N+]#[C-])c1 |
| InChI | InChI=1S/C38H14N8/c1-45-33-11-27(21-43)9-31(13-33)37-15-35(29-5-23(17-39)3-24(6-29)18-40)36(30-7-25(19-41)4-26(8-30)20-42)16-38(37)32-10-28(22-44)12-34(14-32)46-2/h3-16H/i15D,16D |
| InChIKey | JOUSHIKPGSKURU-RAHXUVGXSA-N |
| XLogP | 8.69 |
| TPSA | 151.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.60 |
| LogP ≤ 5 | 8.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|