C9H6N2 — CID 58369567
3-isocyano-5-methylbenzonitrile (PubChem CID 58369567) has the molecular formula C9H6N2 and a molecular weight of 142.16 g/mol. Its IUPAC name is 3-isocyano-5-methylbenzonitrile.
| Compound Name | 3-isocyano-5-methylbenzonitrile |
|---|---|
| PubChem CID | 58369567 |
| Molecular Formula | C9H6N2 |
| Molecular Weight | 142.16 g/mol |
| Exact Mass | 142.05 |
| IUPAC Name | 3-isocyano-5-methylbenzonitrile |
| SMILES | [C-]#[N+]c1cc(C)cc(C#N)c1 |
| InChI | InChI=1S/C9H6N2/c1-7-3-8(6-10)5-9(4-7)11-2/h3-5H,1H3 |
| InChIKey | UKCBKJDDKOJCBP-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 28.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.16 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|