C34H19N5O — CID 169061454
3-[4-(N-[4-(1,3-benzoxazol-2-yl)phenyl]-4-cyanoanilino)phenyl]-5-isocyanobenzonitrile (PubChem CID 169061454) has the molecular formula C34H19N5O and a molecular weight of 513.56 g/mol. Its IUPAC name is 3-[4-(N-[4-(1,3-benzoxazol-2-yl)phenyl]-4-cyanoanilino)phenyl]-5-isocyanobenzonitrile.
| Compound Name | 3-[4-(N-[4-(1,3-benzoxazol-2-yl)phenyl]-4-cyanoanilino)phenyl]-5-isocyanobenzonitrile |
|---|---|
| PubChem CID | 169061454 |
| Molecular Formula | C34H19N5O |
| Molecular Weight | 513.56 g/mol |
| Exact Mass | 513.16 |
| IUPAC Name | 3-[4-(N-[4-(1,3-benzoxazol-2-yl)phenyl]-4-cyanoanilino)phenyl]-5-isocyanobenzonitrile |
| SMILES | [C-]#[N+]c1cc(C#N)cc(-c2ccc(N(c3ccc(C#N)cc3)c3ccc(-c4nc5ccccc5o4)cc3)cc2)c1 |
| InChI | InChI=1S/C34H19N5O/c1-37-28-19-24(22-36)18-27(20-28)25-8-14-30(15-9-25)39(29-12-6-23(21-35)7-13-29)31-16-10-26(11-17-31)34-38-32-4-2-3-5-33(32)40-34/h2-20H |
| InChIKey | FBWQFPAWLXYRDY-UHFFFAOYSA-N |
| XLogP | 8.93 |
| TPSA | 81.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.56 |
| LogP ≤ 5 | 8.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|