C47H28N4O2 — CID 165150291
4-anthracen-2-yl-N,N-bis[4-(1,3-benzoxazol-2-yl)phenyl]-3-isocyanoaniline (PubChem CID 165150291) has the molecular formula C47H28N4O2 and a molecular weight of 680.77 g/mol. Its IUPAC name is 4-anthracen-2-yl-N,N-bis[4-(1,3-benzoxazol-2-yl)phenyl]-3-isocyanoaniline.
| Compound Name | 4-anthracen-2-yl-N,N-bis[4-(1,3-benzoxazol-2-yl)phenyl]-3-isocyanoaniline |
|---|---|
| PubChem CID | 165150291 |
| Molecular Formula | C47H28N4O2 |
| Molecular Weight | 680.77 g/mol |
| Exact Mass | 680.22 |
| IUPAC Name | 4-anthracen-2-yl-N,N-bis[4-(1,3-benzoxazol-2-yl)phenyl]-3-isocyanoaniline |
| SMILES | [C-]#[N+]c1cc(N(c2ccc(-c3nc4ccccc4o3)cc2)c2ccc(-c3nc4ccccc4o3)cc2)ccc1-c1ccc2cc3ccccc3cc2c1 |
| InChI | InChI=1S/C47H28N4O2/c1-48-43-29-39(24-25-40(43)35-15-14-34-26-32-8-2-3-9-33(32)27-36(34)28-35)51(37-20-16-30(17-21-37)46-49-41-10-4-6-12-44(41)52-46)38-22-18-31(19-23-38)47-50-42-11-5-7-13-45(42)53-47/h2-29H |
| InChIKey | YHMPELFSPSLMAW-UHFFFAOYSA-N |
| XLogP | 13.30 |
| TPSA | 59.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.77 |
| LogP ≤ 5 | 13.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|