C34H20Br4N4O4 — CID 159413043
2,2-bis(3,5-dibromophenyl)-1,3-dioxolane;5-[2-(3-cyano-5-isocyanophenyl)-1,3-dioxolan-2-yl]benzene-1,3-dicarbonitrile (PubChem CID 159413043) has the molecular formula C34H20Br4N4O4 and a molecular weight of 868.17 g/mol. Its IUPAC name is 2,2-bis(3,5-dibromophenyl)-1,3-dioxolane;5-[2-(3-cyano-5-isocyanophenyl)-1,3-dioxolan-2-yl]benzene-1,3-dicarbonitrile.
| Compound Name | 2,2-bis(3,5-dibromophenyl)-1,3-dioxolane;5-[2-(3-cyano-5-isocyanophenyl)-1,3-dioxolan-2-yl]benzene-1,3-dicarbonitrile |
|---|---|
| PubChem CID | 159413043 |
| Molecular Formula | C34H20Br4N4O4 |
| Molecular Weight | 868.17 g/mol |
| Exact Mass | 863.82 |
| IUPAC Name | 2,2-bis(3,5-dibromophenyl)-1,3-dioxolane;5-[2-(3-cyano-5-isocyanophenyl)-1,3-dioxolan-2-yl]benzene-1,3-dicarbonitrile |
| SMILES | Brc1cc(Br)cc(C2(c3cc(Br)cc(Br)c3)OCCO2)c1.[C-]#[N+]c1cc(C#N)cc(C2(c3cc(C#N)cc(C#N)c3)OCCO2)c1 |
| InChI | InChI=1S/C19H10N4O2.C15H10Br4O2/c1-23-18-8-15(12-22)7-17(9-18)19(24-2-3-25-19)16-5-13(10-20)4-14(6-16)11-21;16-11-3-9(4-12(17)7-11)15(20-1-2-21-15)10-5-13(18)8-14(19)6-10/h4-9H,2-3H2;3-8H,1-2H2 |
| InChIKey | LOUWLBYDCINGOJ-UHFFFAOYSA-N |
| XLogP | 9.08 |
| TPSA | 112.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 868.17 |
| LogP ≤ 5 | 9.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|