C17H2Cl6N4 — CID 159007773
2,4,5-trichloro-3-isocyano-6-[(2,3,5-trichloro-4-cyano-6-isocyanophenyl)methyl]benzonitrile (PubChem CID 159007773) has the molecular formula C17H2Cl6N4 and a molecular weight of 474.95 g/mol. Its IUPAC name is 2,4,5-trichloro-3-isocyano-6-[(2,3,5-trichloro-4-cyano-6-isocyanophenyl)methyl]benzonitrile.
| Compound Name | 2,4,5-trichloro-3-isocyano-6-[(2,3,5-trichloro-4-cyano-6-isocyanophenyl)methyl]benzonitrile |
|---|---|
| PubChem CID | 159007773 |
| Molecular Formula | C17H2Cl6N4 |
| Molecular Weight | 474.95 g/mol |
| Exact Mass | 471.84 |
| IUPAC Name | 2,4,5-trichloro-3-isocyano-6-[(2,3,5-trichloro-4-cyano-6-isocyanophenyl)methyl]benzonitrile |
| SMILES | [C-]#[N+]c1c(Cl)c(Cl)c(Cc2c(Cl)c(Cl)c(C#N)c(Cl)c2[N+]#[C-])c(C#N)c1Cl |
| InChI | InChI=1S/C17H2Cl6N4/c1-26-16-7(11(19)12(20)9(5-25)14(16)22)3-6-8(4-24)13(21)17(27-2)15(23)10(6)18/h3H2 |
| InChIKey | YIISYAJBMQKYOW-UHFFFAOYSA-N |
| XLogP | 8.04 |
| TPSA | 56.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.95 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|