About [3-[[2,5-bis(trifluoromethyl)phenyl]methyl]-2H-imidazol-1-yl]methanol
[3-[[2,5-bis(trifluoromethyl)phenyl]methyl]-2H-imidazol-1-yl]methanol (PubChem CID 157403943) has the molecular formula C13H12F6N2O
and a molecular weight of 326.24 g/mol. Its IUPAC name is [3-[[2,5-bis(trifluoromethyl)phenyl]methyl]-2H-imidazol-1-yl]methanol.
Molecular Properties
| Compound Name | [3-[[2,5-bis(trifluoromethyl)phenyl]methyl]-2H-imidazol-1-yl]methanol |
| PubChem CID | 157403943 |
| Molecular Formula | C13H12F6N2O |
| Molecular Weight | 326.24 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | [3-[[2,5-bis(trifluoromethyl)phenyl]methyl]-2H-imidazol-1-yl]methanol |
| SMILES | OCN1C=CN(Cc2cc(C(F)(F)F)ccc2C(F)(F)F)C1 |
| InChI | InChI=1S/C13H12F6N2O/c14-12(15,16)10-1-2-11(13(17,18)19)9(5-10)6-20-3-4-21(7-20)8-22/h1-5,22H,6-8H2 |
| InChIKey | BNMMOAYAFZDMNJ-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.24 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [3-[[2,5-bis(trifluoromethyl)phenyl]methyl]-2H-imidazol-1-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[[2,5-bis(trifluoromethyl)phenyl]methyl]-2H-imidazol-1-yl]methanol?
The IUPAC name of [3-[[2,5-bis(trifluoromethyl)phenyl]methyl]-2H-imidazol-1-yl]methanol (CID 157403943) is [3-[[2,5-bis(trifluoromethyl)phenyl]methyl]-2H-imidazol-1-yl]methanol.
What is the SMILES notation for [3-[[2,5-bis(trifluoromethyl)phenyl]methyl]-2H-imidazol-1-yl]methanol?
The canonical SMILES for [3-[[2,5-bis(trifluoromethyl)phenyl]methyl]-2H-imidazol-1-yl]methanol is OCN1C=CN(Cc2cc(C(F)(F)F)ccc2C(F)(F)F)C1.
What is the InChIKey of [3-[[2,5-bis(trifluoromethyl)phenyl]methyl]-2H-imidazol-1-yl]methanol?
The InChIKey is BNMMOAYAFZDMNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12F6N2O/c14-12(15,16)10-1-2-11(13(17,18)19)9(5-10)6-20-3-4-21(7-20)8-22/h1-5,22H,6-8H2.
What are the key properties of [3-[[2,5-bis(trifluoromethyl)phenyl]methyl]-2H-imidazol-1-yl]methanol?
[3-[[2,5-bis(trifluoromethyl)phenyl]methyl]-2H-imidazol-1-yl]methanol has a molecular weight of 326.24 g/mol, XLogP of 3.22, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[[2,5-bis(trifluoromethyl)phenyl]methyl]-2H-imidazol-1-yl]methanol is sourced from PubChem (CID 157403943), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).