C13H8Cl2O7 — CID 175049716
bis(6-chloro-2,3,4-trihydroxyphenyl)methanone (PubChem CID 175049716) has the molecular formula C13H8Cl2O7 and a molecular weight of 347.11 g/mol. Its IUPAC name is bis(6-chloro-2,3,4-trihydroxyphenyl)methanone.
| Compound Name | bis(6-chloro-2,3,4-trihydroxyphenyl)methanone |
|---|---|
| PubChem CID | 175049716 |
| Molecular Formula | C13H8Cl2O7 |
| Molecular Weight | 347.11 g/mol |
| Exact Mass | 345.96 |
| IUPAC Name | bis(6-chloro-2,3,4-trihydroxyphenyl)methanone |
| SMILES | O=C(c1c(Cl)cc(O)c(O)c1O)c1c(Cl)cc(O)c(O)c1O |
| InChI | InChI=1S/C13H8Cl2O7/c14-3-1-5(16)9(18)12(21)7(3)11(20)8-4(15)2-6(17)10(19)13(8)22/h1-2,16-19,21-22H |
| InChIKey | ZHTLZKWKBMKGAW-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 138.45 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.11 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|