C14H13ClO6-2 — CID 53440062
4-chloronaphthalene-1,2-diol diacetate (PubChem CID 53440062) has the molecular formula C14H13ClO6-2 and a molecular weight of 312.71 g/mol. Its IUPAC name is 4-chloronaphthalene-1,2-diol diacetate.
| Compound Name | 4-chloronaphthalene-1,2-diol diacetate |
|---|---|
| PubChem CID | 53440062 |
| Molecular Formula | C14H13ClO6-2 |
| Molecular Weight | 312.71 g/mol |
| Exact Mass | 312.04 |
| IUPAC Name | 4-chloronaphthalene-1,2-diol diacetate |
| SMILES | CC(=O)[O-].CC(=O)[O-].Oc1cc(Cl)c2ccccc2c1O |
| InChI | InChI=1S/C10H7ClO2.2C2H4O2/c11-8-5-9(12)10(13)7-4-2-1-3-6(7)8;2*1-2(3)4/h1-5,12-13H;2*1H3,(H,3,4)/p-2 |
| InChIKey | VDRRSGOCAPAYBL-UHFFFAOYSA-L |
| XLogP | 0.42 |
| TPSA | 120.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.71 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|