C14H11ClO4 — CID 166522827
(6-chloro-2,3,4-trihydroxyphenyl)-(4-methylphenyl)methanone (PubChem CID 166522827) has the molecular formula C14H11ClO4 and a molecular weight of 278.69 g/mol. Its IUPAC name is (6-chloro-2,3,4-trihydroxyphenyl)-(4-methylphenyl)methanone.
| Compound Name | (6-chloro-2,3,4-trihydroxyphenyl)-(4-methylphenyl)methanone |
|---|---|
| PubChem CID | 166522827 |
| Molecular Formula | C14H11ClO4 |
| Molecular Weight | 278.69 g/mol |
| Exact Mass | 278.03 |
| IUPAC Name | (6-chloro-2,3,4-trihydroxyphenyl)-(4-methylphenyl)methanone |
| SMILES | Cc1ccc(C(=O)c2c(Cl)cc(O)c(O)c2O)cc1 |
| InChI | InChI=1S/C14H11ClO4/c1-7-2-4-8(5-3-7)12(17)11-9(15)6-10(16)13(18)14(11)19/h2-6,16,18-19H,1H3 |
| InChIKey | GENVPVMYDCDGJA-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.69 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|