C14H11BrO3 — CID 150034437
(3-bromo-4,5-dihydroxyphenyl)-(4-methylphenyl)methanone (PubChem CID 150034437) has the molecular formula C14H11BrO3 and a molecular weight of 307.14 g/mol. Its IUPAC name is (3-bromo-4,5-dihydroxyphenyl)-(4-methylphenyl)methanone.
| Compound Name | (3-bromo-4,5-dihydroxyphenyl)-(4-methylphenyl)methanone |
|---|---|
| PubChem CID | 150034437 |
| Molecular Formula | C14H11BrO3 |
| Molecular Weight | 307.14 g/mol |
| Exact Mass | 305.99 |
| IUPAC Name | (3-bromo-4,5-dihydroxyphenyl)-(4-methylphenyl)methanone |
| SMILES | Cc1ccc(C(=O)c2cc(O)c(O)c(Br)c2)cc1 |
| InChI | InChI=1S/C14H11BrO3/c1-8-2-4-9(5-3-8)13(17)10-6-11(15)14(18)12(16)7-10/h2-7,16,18H,1H3 |
| InChIKey | DHYMLMONQVBPHN-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.14 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|