C19H15NO7 — CID 90938997
(2,5-dihydroxypyrrol-1-yl) 2,3-dihydroxy-5-(4-methylbenzoyl)benzoate (PubChem CID 90938997) has the molecular formula C19H15NO7 and a molecular weight of 369.33 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) 2,3-dihydroxy-5-(4-methylbenzoyl)benzoate.
| Compound Name | (2,5-dihydroxypyrrol-1-yl) 2,3-dihydroxy-5-(4-methylbenzoyl)benzoate |
|---|---|
| PubChem CID | 90938997 |
| Molecular Formula | C19H15NO7 |
| Molecular Weight | 369.33 g/mol |
| Exact Mass | 369.08 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) 2,3-dihydroxy-5-(4-methylbenzoyl)benzoate |
| SMILES | Cc1ccc(C(=O)c2cc(O)c(O)c(C(=O)On3c(O)ccc3O)c2)cc1 |
| InChI | InChI=1S/C19H15NO7/c1-10-2-4-11(5-3-10)17(24)12-8-13(18(25)14(21)9-12)19(26)27-20-15(22)6-7-16(20)23/h2-9,21-23,25H,1H3 |
| InChIKey | OEJVWDJBCUFJIZ-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 129.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.33 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|