C14H12FNO3 — CID 88742758
(3-amino-5-fluoro-2,4-dihydroxyphenyl)-(4-methylphenyl)methanone (PubChem CID 88742758) has the molecular formula C14H12FNO3 and a molecular weight of 261.25 g/mol. Its IUPAC name is (3-amino-5-fluoro-2,4-dihydroxyphenyl)-(4-methylphenyl)methanone.
| Compound Name | (3-amino-5-fluoro-2,4-dihydroxyphenyl)-(4-methylphenyl)methanone |
|---|---|
| PubChem CID | 88742758 |
| Molecular Formula | C14H12FNO3 |
| Molecular Weight | 261.25 g/mol |
| Exact Mass | 261.08 |
| IUPAC Name | (3-amino-5-fluoro-2,4-dihydroxyphenyl)-(4-methylphenyl)methanone |
| SMILES | Cc1ccc(C(=O)c2cc(F)c(O)c(N)c2O)cc1 |
| InChI | InChI=1S/C14H12FNO3/c1-7-2-4-8(5-3-7)12(17)9-6-10(15)14(19)11(16)13(9)18/h2-6,18-19H,16H2,1H3 |
| InChIKey | KRUWOKCLFONBDX-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.25 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|