C13H10N2O4 — CID 141115220
2,3-dihydroxy-5-(pyridine-4-carbonyl)benzamide (PubChem CID 141115220) has the molecular formula C13H10N2O4 and a molecular weight of 258.23 g/mol. Its IUPAC name is 2,3-dihydroxy-5-(pyridine-4-carbonyl)benzamide.
| Compound Name | 2,3-dihydroxy-5-(pyridine-4-carbonyl)benzamide |
|---|---|
| PubChem CID | 141115220 |
| Molecular Formula | C13H10N2O4 |
| Molecular Weight | 258.23 g/mol |
| Exact Mass | 258.06 |
| IUPAC Name | 2,3-dihydroxy-5-(pyridine-4-carbonyl)benzamide |
| SMILES | NC(=O)c1cc(C(=O)c2ccncc2)cc(O)c1O |
| InChI | InChI=1S/C13H10N2O4/c14-13(19)9-5-8(6-10(16)12(9)18)11(17)7-1-3-15-4-2-7/h1-6,16,18H,(H2,14,19) |
| InChIKey | QDFNGNAIXPNSPC-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 113.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.23 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|