C13H10O9 — CID 146549793
(2,3,4,5,6-pentahydroxyphenyl)-(3,4,5-trihydroxyphenyl)methanone (PubChem CID 146549793) has the molecular formula C13H10O9 and a molecular weight of 310.21 g/mol. Its IUPAC name is (2,3,4,5,6-pentahydroxyphenyl)-(3,4,5-trihydroxyphenyl)methanone.
| Compound Name | (2,3,4,5,6-pentahydroxyphenyl)-(3,4,5-trihydroxyphenyl)methanone |
|---|---|
| PubChem CID | 146549793 |
| Molecular Formula | C13H10O9 |
| Molecular Weight | 310.21 g/mol |
| Exact Mass | 310.03 |
| IUPAC Name | (2,3,4,5,6-pentahydroxyphenyl)-(3,4,5-trihydroxyphenyl)methanone |
| SMILES | O=C(c1cc(O)c(O)c(O)c1)c1c(O)c(O)c(O)c(O)c1O |
| InChI | InChI=1S/C13H10O9/c14-4-1-3(2-5(15)8(4)17)7(16)6-9(18)11(20)13(22)12(21)10(6)19/h1-2,14-15,17-22H |
| InChIKey | XSAYQXXSJJWGGY-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 178.91 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.21 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|