C14H10Cl2O4 — CID 102033075
2-(2,4-dichlorophenyl)-1-(2,3,4-trihydroxyphenyl)ethanone (PubChem CID 102033075) has the molecular formula C14H10Cl2O4 and a molecular weight of 313.14 g/mol. Its IUPAC name is 2-(2,4-dichlorophenyl)-1-(2,3,4-trihydroxyphenyl)ethanone.
| Compound Name | 2-(2,4-dichlorophenyl)-1-(2,3,4-trihydroxyphenyl)ethanone |
|---|---|
| PubChem CID | 102033075 |
| Molecular Formula | C14H10Cl2O4 |
| Molecular Weight | 313.14 g/mol |
| Exact Mass | 312.00 |
| IUPAC Name | 2-(2,4-dichlorophenyl)-1-(2,3,4-trihydroxyphenyl)ethanone |
| SMILES | O=C(Cc1ccc(Cl)cc1Cl)c1ccc(O)c(O)c1O |
| InChI | InChI=1S/C14H10Cl2O4/c15-8-2-1-7(10(16)6-8)5-12(18)9-3-4-11(17)14(20)13(9)19/h1-4,6,17,19-20H,5H2 |
| InChIKey | SBMHGDXAXICJCI-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.14 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|