C16H10Cl2OS — CID 81153455
1-(1-benzothiophen-7-yl)-2-(2,4-dichlorophenyl)ethanone (PubChem CID 81153455) has the molecular formula C16H10Cl2OS and a molecular weight of 321.23 g/mol. Its IUPAC name is 1-(1-benzothiophen-7-yl)-2-(2,4-dichlorophenyl)ethanone.
| Compound Name | 1-(1-benzothiophen-7-yl)-2-(2,4-dichlorophenyl)ethanone |
|---|---|
| PubChem CID | 81153455 |
| Molecular Formula | C16H10Cl2OS |
| Molecular Weight | 321.23 g/mol |
| Exact Mass | 319.98 |
| IUPAC Name | 1-(1-benzothiophen-7-yl)-2-(2,4-dichlorophenyl)ethanone |
| SMILES | O=C(Cc1ccc(Cl)cc1Cl)c1cccc2ccsc12 |
| InChI | InChI=1S/C16H10Cl2OS/c17-12-5-4-11(14(18)9-12)8-15(19)13-3-1-2-10-6-7-20-16(10)13/h1-7,9H,8H2 |
| InChIKey | QEQVSCOIJZRFML-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.23 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |