C15H8F2OS — CID 81153363
1-benzothiophen-7-yl-(2,5-difluorophenyl)methanone (PubChem CID 81153363) has the molecular formula C15H8F2OS and a molecular weight of 274.29 g/mol. Its IUPAC name is 1-benzothiophen-7-yl-(2,5-difluorophenyl)methanone.
| Compound Name | 1-benzothiophen-7-yl-(2,5-difluorophenyl)methanone |
|---|---|
| PubChem CID | 81153363 |
| Molecular Formula | C15H8F2OS |
| Molecular Weight | 274.29 g/mol |
| Exact Mass | 274.03 |
| IUPAC Name | 1-benzothiophen-7-yl-(2,5-difluorophenyl)methanone |
| SMILES | O=C(c1cc(F)ccc1F)c1cccc2ccsc12 |
| InChI | InChI=1S/C15H8F2OS/c16-10-4-5-13(17)12(8-10)14(18)11-3-1-2-9-6-7-19-15(9)11/h1-8H |
| InChIKey | SHIFFUFDQZHTCJ-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.29 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |