C11H6N2OS2 — CID 105122061
1-benzothiophen-7-yl(1,2,5-thiadiazol-3-yl)methanone (PubChem CID 105122061) has the molecular formula C11H6N2OS2 and a molecular weight of 246.32 g/mol. Its IUPAC name is 1-benzothiophen-7-yl(1,2,5-thiadiazol-3-yl)methanone.
| Compound Name | 1-benzothiophen-7-yl(1,2,5-thiadiazol-3-yl)methanone |
|---|---|
| PubChem CID | 105122061 |
| Molecular Formula | C11H6N2OS2 |
| Molecular Weight | 246.32 g/mol |
| Exact Mass | 245.99 |
| IUPAC Name | 1-benzothiophen-7-yl(1,2,5-thiadiazol-3-yl)methanone |
| SMILES | O=C(c1cnsn1)c1cccc2ccsc12 |
| InChI | InChI=1S/C11H6N2OS2/c14-10(9-6-12-16-13-9)8-3-1-2-7-4-5-15-11(7)8/h1-6H |
| InChIKey | LXLRUXXDMRDBAJ-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.32 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |