C9H5ClN2OS — CID 105081414
(2-chlorophenyl)-(1,2,5-thiadiazol-3-yl)methanone (PubChem CID 105081414) has the molecular formula C9H5ClN2OS and a molecular weight of 224.67 g/mol. Its IUPAC name is (2-chlorophenyl)-(1,2,5-thiadiazol-3-yl)methanone.
| Compound Name | (2-chlorophenyl)-(1,2,5-thiadiazol-3-yl)methanone |
|---|---|
| PubChem CID | 105081414 |
| Molecular Formula | C9H5ClN2OS |
| Molecular Weight | 224.67 g/mol |
| Exact Mass | 223.98 |
| IUPAC Name | (2-chlorophenyl)-(1,2,5-thiadiazol-3-yl)methanone |
| SMILES | O=C(c1cnsn1)c1ccccc1Cl |
| InChI | InChI=1S/C9H5ClN2OS/c10-7-4-2-1-3-6(7)9(13)8-5-11-14-12-8/h1-5H |
| InChIKey | QHTTXROCRMVQMY-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.67 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |