C9H4Cl2N2OS — CID 105094942
(2,3-dichlorophenyl)-(1,2,5-thiadiazol-3-yl)methanone (PubChem CID 105094942) has the molecular formula C9H4Cl2N2OS and a molecular weight of 259.12 g/mol. Its IUPAC name is (2,3-dichlorophenyl)-(1,2,5-thiadiazol-3-yl)methanone.
| Compound Name | (2,3-dichlorophenyl)-(1,2,5-thiadiazol-3-yl)methanone |
|---|---|
| PubChem CID | 105094942 |
| Molecular Formula | C9H4Cl2N2OS |
| Molecular Weight | 259.12 g/mol |
| Exact Mass | 257.94 |
| IUPAC Name | (2,3-dichlorophenyl)-(1,2,5-thiadiazol-3-yl)methanone |
| SMILES | O=C(c1cnsn1)c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C9H4Cl2N2OS/c10-6-3-1-2-5(8(6)11)9(14)7-4-12-15-13-7/h1-4H |
| InChIKey | UDWPVADQRAPGSV-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.12 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |