C11H6Cl3N3O — CID 113229005
2,3-dichloro-N-(6-chloropyrazin-2-yl)benzamide (PubChem CID 113229005) has the molecular formula C11H6Cl3N3O and a molecular weight of 302.55 g/mol. Its IUPAC name is 2,3-dichloro-N-(6-chloropyrazin-2-yl)benzamide.
| Compound Name | 2,3-dichloro-N-(6-chloropyrazin-2-yl)benzamide |
|---|---|
| PubChem CID | 113229005 |
| Molecular Formula | C11H6Cl3N3O |
| Molecular Weight | 302.55 g/mol |
| Exact Mass | 300.96 |
| IUPAC Name | 2,3-dichloro-N-(6-chloropyrazin-2-yl)benzamide |
| SMILES | O=C(Nc1cncc(Cl)n1)c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C11H6Cl3N3O/c12-7-3-1-2-6(10(7)14)11(18)17-9-5-15-4-8(13)16-9/h1-5H,(H,16,17,18) |
| InChIKey | ZWPGZWLSDJAOHO-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.55 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |