C13H8Cl2N2O2 — CID 54312256
2,3-dichloro-N-(5-formyl-2-pyridinyl)benzamide (PubChem CID 54312256) has the molecular formula C13H8Cl2N2O2 and a molecular weight of 295.12 g/mol. Its IUPAC name is 2,3-dichloro-N-(5-formyl-2-pyridinyl)benzamide.
| Compound Name | 2,3-dichloro-N-(5-formyl-2-pyridinyl)benzamide |
|---|---|
| PubChem CID | 54312256 |
| Molecular Formula | C13H8Cl2N2O2 |
| Molecular Weight | 295.12 g/mol |
| Exact Mass | 294.00 |
| IUPAC Name | 2,3-dichloro-N-(5-formyl-2-pyridinyl)benzamide |
| SMILES | O=Cc1ccc(NC(=O)c2cccc(Cl)c2Cl)nc1 |
| InChI | InChI=1S/C13H8Cl2N2O2/c14-10-3-1-2-9(12(10)15)13(19)17-11-5-4-8(7-18)6-16-11/h1-7H,(H,16,17,19) |
| InChIKey | YXOGZLRTHKVLOF-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.12 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|