C14H11ClN2O2 — CID 57251088
2-(2-chlorophenyl)-N-(5-formyl-2-pyridinyl)acetamide (PubChem CID 57251088) has the molecular formula C14H11ClN2O2 and a molecular weight of 274.71 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-N-(5-formyl-2-pyridinyl)acetamide.
| Compound Name | 2-(2-chlorophenyl)-N-(5-formyl-2-pyridinyl)acetamide |
|---|---|
| PubChem CID | 57251088 |
| Molecular Formula | C14H11ClN2O2 |
| Molecular Weight | 274.71 g/mol |
| Exact Mass | 274.05 |
| IUPAC Name | 2-(2-chlorophenyl)-N-(5-formyl-2-pyridinyl)acetamide |
| SMILES | O=Cc1ccc(NC(=O)Cc2ccccc2Cl)nc1 |
| InChI | InChI=1S/C14H11ClN2O2/c15-12-4-2-1-3-11(12)7-14(19)17-13-6-5-10(9-18)8-16-13/h1-6,8-9H,7H2,(H,16,17,19) |
| InChIKey | QDBNFOHQTAUCHO-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.71 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|