C13H9Cl2NO — CID 116548558
(3-aminophenyl)-(2,3-dichlorophenyl)methanone (PubChem CID 116548558) has the molecular formula C13H9Cl2NO and a molecular weight of 266.13 g/mol. Its IUPAC name is (3-aminophenyl)-(2,3-dichlorophenyl)methanone.
| Compound Name | (3-aminophenyl)-(2,3-dichlorophenyl)methanone |
|---|---|
| PubChem CID | 116548558 |
| Molecular Formula | C13H9Cl2NO |
| Molecular Weight | 266.13 g/mol |
| Exact Mass | 265.01 |
| IUPAC Name | (3-aminophenyl)-(2,3-dichlorophenyl)methanone |
| SMILES | Nc1cccc(C(=O)c2cccc(Cl)c2Cl)c1 |
| InChI | InChI=1S/C13H9Cl2NO/c14-11-6-2-5-10(12(11)15)13(17)8-3-1-4-9(16)7-8/h1-7H,16H2 |
| InChIKey | UOUAMOZLRTWDFA-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.13 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|