C10H6ClNO2 — CID 12013130
(2-chlorophenyl)-(1,2-oxazol-3-yl)methanone (PubChem CID 12013130) has the molecular formula C10H6ClNO2 and a molecular weight of 207.62 g/mol. Its IUPAC name is (2-chlorophenyl)-(1,2-oxazol-3-yl)methanone.
| Compound Name | (2-chlorophenyl)-(1,2-oxazol-3-yl)methanone |
|---|---|
| PubChem CID | 12013130 |
| Molecular Formula | C10H6ClNO2 |
| Molecular Weight | 207.62 g/mol |
| Exact Mass | 207.01 |
| IUPAC Name | (2-chlorophenyl)-(1,2-oxazol-3-yl)methanone |
| SMILES | O=C(c1ccon1)c1ccccc1Cl |
| InChI | InChI=1S/C10H6ClNO2/c11-8-4-2-1-3-7(8)10(13)9-5-6-14-12-9/h1-6H |
| InChIKey | MWXNILNKIYBXBH-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.62 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |