C11H12ClNO4 — CID 144618082
(1Z)-1-(3-chloro-4,5-dihydroxyphenyl)-1-hydroxyimino-3-methylbutan-2-one (PubChem CID 144618082) has the molecular formula C11H12ClNO4 and a molecular weight of 257.67 g/mol. Its IUPAC name is (1Z)-1-(3-chloro-4,5-dihydroxyphenyl)-1-hydroxyimino-3-methylbutan-2-one.
| Compound Name | (1Z)-1-(3-chloro-4,5-dihydroxyphenyl)-1-hydroxyimino-3-methylbutan-2-one |
|---|---|
| PubChem CID | 144618082 |
| Molecular Formula | C11H12ClNO4 |
| Molecular Weight | 257.67 g/mol |
| Exact Mass | 257.05 |
| IUPAC Name | (1Z)-1-(3-chloro-4,5-dihydroxyphenyl)-1-hydroxyimino-3-methylbutan-2-one |
| SMILES | CC(C)C(=O)/C(=N\O)c1cc(O)c(O)c(Cl)c1 |
| InChI | InChI=1S/C11H12ClNO4/c1-5(2)10(15)9(13-17)6-3-7(12)11(16)8(14)4-6/h3-5,14,16-17H,1-2H3/b13-9- |
| InChIKey | KUNPCFZBKCLPCK-LCYFTJDESA-N |
| XLogP | 2.15 |
| TPSA | 90.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.67 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'} |
|---|